886365-57-7 Usage
General Description
4-(1-CBZ-piperidin-3-yl)-butyric acid is a chemical compound consisting of a piperidine ring with a carboxylic acid group attached to a four-carbon chain. It is often used in the synthesis of pharmaceuticals and organic compounds due to its versatile chemical structure. The presence of the piperidine ring makes it a valuable building block for the synthesis of numerous drug candidates, as piperidine is a common structure in many bioactive compounds. Additionally, the carboxylic acid group allows for the compound to be easily manipulated and modified for specific chemical reactions or applications. Overall, this chemical has potential use in the development of various pharmaceuticals and organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 886365-57-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 886365-57:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*5)+(2*5)+(1*7)=227
227 % 10 = 7
So 886365-57-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H23NO4/c19-16(20)10-4-8-14-9-5-11-18(12-14)17(21)22-13-15-6-2-1-3-7-15/h1-3,6-7,14H,4-5,8-13H2,(H,19,20)
