886366-29-6 Usage
Uses
Used in Pharmaceutical Industry:
3-(4-Hydroxy-3-methoxyphenyl)-DL-beta-alaninol is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the hydroxyl and methoxy groups, may contribute to the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
In the field of chemical research, 3-(4-Hydroxy-3-methoxyphenyl)-DL-beta-alaninol serves as a valuable compound for studying the properties and reactions of phenolic derivatives and amino acids. Its polar nature and potential for hydrogen bonding make it an interesting subject for exploring interactions with other molecules and understanding its reactivity.
Used in Industrial Applications:
3-(4-Hydroxy-3-methoxyphenyl)-DL-beta-alaninol may be utilized in industrial processes as a specialty chemical, where its specific properties could be harnessed for the production of various products. 3-(4-HYDROXY-3-METHOXYPHENYL)-DL-BETA-ALANINOL's potential applications in this context would depend on the requirements of the specific industry and the properties that are most desirable for the end product.
Check Digit Verification of cas no
The CAS Registry Mumber 886366-29-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886366-29:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*6)+(2*2)+(1*9)=226
226 % 10 = 6
So 886366-29-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO3/c1-14-10-5-7(2-3-9(10)13)4-8(11)6-12/h2-3,5,8,12-13H,4,6,11H2,1H3/t8-/m0/s1
