886366-70-7 Usage
Uses
Used in Pharmaceutical Industry:
3-(3-Phenoxyphenyl)-DL-beta-alaninol is used as a building block in the synthesis of pharmaceuticals for its potential biological activities. Its antimicrobial, antioxidant, and anti-inflammatory properties make it a valuable compound in the development of new drugs and treatments.
Used in Agrochemical Industry:
3-(3-Phenoxyphenyl)-DL-beta-alaninol is also used as a building block in the synthesis of agrochemicals, where its biological activities can contribute to the development of effective pesticides, herbicides, or other agricultural products.
Used in Coordination Chemistry:
The phenoxy group in 3-(3-Phenoxyphenyl)-DL-beta-alaninol may have implications for its use as a ligand in coordination chemistry, allowing for the formation of coordination complexes with various metal ions.
Used in Organic Synthesis:
The phenoxy group in the molecule can also serve as a functional group in organic synthesis, enabling the creation of new organic compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 886366-70-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 886366-70:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*6)+(2*7)+(1*0)=227
227 % 10 = 7
So 886366-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO2/c16-15(9-10-17)12-5-4-8-14(11-12)18-13-6-2-1-3-7-13/h1-8,11,15,17H,9-10,16H2
