886368-88-3 Usage
Uses
Used in Pharmaceutical Development:
5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid is utilized as a key intermediate in the synthesis of pharmaceutical drugs due to its unique structural features. Its presence of a fluorine atom and a carboxylic acid group can enhance the compound's reactivity and binding affinity to biological targets, making it a valuable component in the creation of new medications.
Used in Medicinal Chemistry Research:
As a member of the indazole class, 5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid serves as a starting material for further chemical modifications and optimizations in medicinal chemistry research. Its potential to be modified and functionalized allows for the exploration of its properties and the development of novel biologically active compounds with improved pharmacological profiles.
Used in Drug Discovery:
5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid is employed as a scaffold in drug discovery processes, where its chemical structure can be systematically varied to identify new lead compounds with therapeutic potential. 5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid's ability to be modified and its presence in various chemical libraries make it a useful tool for high-throughput screening and structure-activity relationship studies.
Used in Biochemical Studies:
5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid may also be used in biochemical studies to investigate its interactions with enzymes, receptors, or other biological macromolecules. Understanding these interactions can provide insights into the compound's mechanism of action and its potential applications in treating specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 886368-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 8 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886368-88:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*8)+(2*8)+(1*8)=243
243 % 10 = 3
So 886368-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FN2O2/c1-12-7-3-2-5(10)4-6(7)8(11-12)9(13)14/h2-4H,1H3,(H,13,14)
