88642-86-8 Usage
Structure
Contains an amino group, a boron atom, and a sulfanyl group
Potential Therapeutic Applications
Studied for its ability to inhibit enzymes involved in processes such as cell growth and division
Cancer Treatment
Potential candidate for cancer treatment due to its enzyme inhibition properties
Interaction with Proteins and Enzymes
Boronic acid group can interact with specific proteins and enzymes
Targeted Therapies Development
Useful in the development of targeted therapies due to its unique structure
Promising Compound
Unique structure makes it a promising compound for further research and development in medicinal chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 88642-86-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,6,4 and 2 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 88642-86:
(7*8)+(6*8)+(5*6)+(4*4)+(3*2)+(2*8)+(1*6)=178
178 % 10 = 8
So 88642-86-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H12BNO4S/c7-4(5(8)9)3-12-2-1-6(10)11/h4,10-11H,1-3,7H2,(H,8,9)
