886497-51-4 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Dichloro-6-fluorobenzyl bromide is used as a key intermediate in the synthesis of pharmaceutical compounds for various therapeutic applications. Its reactivity with nucleophiles and ability to undergo substitution reactions make it an essential component in the development of new drugs and bioactive molecules.
Used in Organic Synthesis:
In the field of organic synthesis, 2,3-dichloro-6-fluorobenzyl bromide is utilized as a valuable reagent for creating a wide range of organic compounds. Its unique properties allow for the formation of new chemical bonds and the construction of complex molecular structures, contributing to the advancement of chemical research and the creation of novel materials.
Check Digit Verification of cas no
The CAS Registry Mumber 886497-51-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,4,9 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 886497-51:
(8*8)+(7*8)+(6*6)+(5*4)+(4*9)+(3*7)+(2*5)+(1*1)=244
244 % 10 = 4
So 886497-51-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrCl2F/c8-3-4-6(11)2-1-5(9)7(4)10/h1-2H,3H2
886497-51-4Relevant academic research and scientific papers
CHEMICAL PROCESS
-
Page/Page column 5, (2008/06/13)
The present invention concerns a process for the preparation of a compound of formula (I): the process comprising a. reducing aldehyde of formula (III): with an alkali metal borohydride in ethanol to give compound of formula (IV): b. halogenating a compou
