886497-84-3 Usage
Uses
Used in Pharmaceutical Industry:
3-BROMOBENZYLMERCAPTAN is used as a synthetic intermediate for the development of various pharmaceutical agents, including antibiotics, antihistaminic agents, and muscarinic agonists. It plays a crucial role in the treatment of Alzheimer's disease and other neurological conditions.
Used in Chemical Synthesis:
3-BROMOBENZYLMERCAPTAN is used as a synthetic intermediate for the production of nucleosides, rotaxanes, chemiluminiscent compounds, and polyheterocyclic compounds with neuroleptic activity. These compounds have potential applications in various fields, such as medicine, materials science, and analytical chemistry.
Used in Industrial Applications:
3-BROMOBENZYLMERCAPTAN is used in various industrial applications, such as plant growth regulators, optical brighteners, corrosion inhibitors, and photostabilizers for fibers, plastics, or dyes. Its versatile properties make it a valuable compound in the development of new materials and products.
Used in Production of (4-bromo-benzyl)-phenyl ether:
3-BROMOBENZYLMERCAPTAN can be used to produce (4-bromo-benzyl)-phenyl ether, which is an important compound with potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 886497-84-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,4,9 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 886497-84:
(8*8)+(7*8)+(6*6)+(5*4)+(4*9)+(3*7)+(2*8)+(1*4)=253
253 % 10 = 3
So 886497-84-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrS/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2
