886499-83-8 Usage
Uses
Used in Chemical Synthesis Industry:
2-BROMO-6-CHLORO-4-FLUOROPHENOL is used as a key intermediate in the synthesis of various chemical products, such as resins, dyes, explosives, lubricants, and plastics. Its unique structure allows for the formation of new chemical bonds and reactions, contributing to the development of a wide array of materials with specific properties.
Used in Antioxidant Formulations:
2-BROMO-6-CHLORO-4-FLUOROPHENOL is endowed with antioxidant properties, making it a valuable component in various formulations. It serves as an antioxidant in industries such as pharmaceuticals, cosmetics, electrical transformer oil, solvents, and organic reactions. Its ability to prevent oxidation helps in extending the shelf life and maintaining the quality of products in these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 886499-83-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,4,9 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 886499-83:
(8*8)+(7*8)+(6*6)+(5*4)+(4*9)+(3*9)+(2*8)+(1*3)=258
258 % 10 = 8
So 886499-83-8 is a valid CAS Registry Number.
InChI:InChI=1S/C6H3BrClFO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H
