886503-79-3 Usage
Uses
Used in Pharmaceutical Industry:
2,3-Difluoro-4-methylaniline is used as an intermediate in the synthesis of various pharmaceuticals for its ability to impart specific biological activities to the final drug molecules. Its unique structure allows for the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3-difluoro-4-methylaniline serves as a key building block in the production of pesticides and other crop protection agents. Its incorporation into these compounds can enhance their effectiveness in controlling pests and diseases, thereby contributing to increased crop yields and food security.
Used in Dye Industry:
2,3-Difluoro-4-methylaniline is utilized in the synthesis of dyes, particularly those with specific color properties and stability. Its presence in dye molecules can result in improved colorfastness and resistance to environmental factors, making it suitable for various applications such as textiles, plastics, and printing inks.
Used in Research and Development:
2,3-Difluoro-4-methylaniline plays a significant role in research and development, particularly in the fields of organic and medicinal chemistry. It is employed as a model compound for studying reaction mechanisms, exploring new synthetic routes, and understanding the structure-activity relationships of various chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 886503-79-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,5,0 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886503-79:
(8*8)+(7*8)+(6*6)+(5*5)+(4*0)+(3*3)+(2*7)+(1*9)=213
213 % 10 = 3
So 886503-79-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7F2N/c1-4-2-3-5(10)7(9)6(4)8/h2-3H,10H2,1H3
886503-79-3Relevant academic research and scientific papers
COMPOUNDS WHICH HAVE ACTIVITY AT M1 RECEPTOR AND THEIR USES IN MEDICINE
-
Page/Page column 49, (2010/11/26)
Compounds which have activity at M1 receptor and their uses in medicine Compounds of formula (I) and salts and solvates are provided: wherein R4 is fluoro, R5 is selected from hydrogen, halogen, cyano, C1-6alkyl
