886510-25-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-5-fluoro-2-methoxyphenol is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of anti-inflammatory and anti-cancer drugs. Its unique structure allows for the creation of molecules with specific therapeutic properties, making it a valuable component in medicinal chemistry.
Safety and Storage:
Due to its potential hazards, 4-Bromo-5-fluoro-2-methoxyphenol should be handled and stored with caution. It can be harmful if ingested, inhaled, or absorbed through the skin, necessitating proper safety measures during its use. It is recommended to keep the compound in a cool, dry place, away from direct sunlight and sources of ignition to ensure its stability and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 886510-25-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,5,1 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 886510-25:
(8*8)+(7*8)+(6*6)+(5*5)+(4*1)+(3*0)+(2*2)+(1*5)=194
194 % 10 = 4
So 886510-25-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrFO2/c1-11-7-2-4(8)5(9)3-6(7)10/h2-3,10H,1H3
