886745-59-1 Usage
Description
5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid is a chemical compound with the molecular formula C10H7N2O5S. It is a derivative of benzo[d]thiazole and contains a methoxy group, a nitro group, and a carboxylic acid group. 5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid is commonly used in organic synthesis and medicinal chemistry as a building block for the synthesis of pharmaceuticals and bioactive molecules. It has also been studied for its potential pharmacological and biological properties, including its antimicrobial and antifungal activities.
Uses
Used in Organic Synthesis:
5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid is used as a building block in organic synthesis for the creation of various pharmaceuticals and bioactive molecules. Its unique structure and functional groups make it a versatile component in the development of new compounds.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid is utilized as a key intermediate in the synthesis of drugs and therapeutic agents. Its presence in the molecular structure can contribute to the desired pharmacological properties of the final product.
Used in Antimicrobial Applications:
5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid has been studied for its antimicrobial properties, making it a potential candidate for use in the development of new antibiotics or antimicrobial agents. Its ability to inhibit the growth of certain bacteria can be harnessed to create effective treatments.
Used in Antifungal Applications:
Similarly, this compound has also demonstrated antifungal activity, which can be utilized in the development of antifungal medications. Its potential to combat fungal infections makes it a valuable asset in the field of medical research and drug development.
Used in Pharmaceutical Industry:
5-methoxy-4-nitrobenzo[d]thiazole-2-carboxylic acid is used as a key component in the pharmaceutical industry for the synthesis of various drugs and therapeutic agents. Its unique chemical properties and potential biological activities make it an important molecule in the development of new medications.
Check Digit Verification of cas no
The CAS Registry Mumber 886745-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,7,4 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886745-59:
(8*8)+(7*8)+(6*6)+(5*7)+(4*4)+(3*5)+(2*5)+(1*9)=241
241 % 10 = 1
So 886745-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O5S/c1-16-4-2-3-5-6(7(4)11(14)15)10-8(17-5)9(12)13/h2-3H,1H3,(H,12,13)
886745-59-1Relevant articles and documents
INHIBITORS OF CDC PHOSPHATASES
-
Page/Page column 19, (2009/12/02)
A subject of the present invention is novel compounds comprising 2 or 3 benzothiazole-4,7-dione- or benzooxazole-4,7-dione-type units, which inhibit the cdc25 phosphatases, in particular cdc25-C phosphatase. These compounds can in particular be used in the treatment of cancer.
