886851-48-5 Usage
Description
N-methyl-4-pyrimidin-2-ylbenzylamine is a chemical compound with the molecular formula C14H15N3. It is a derivative of benzylamine, featuring a methyl group attached to the nitrogen atom and a heterocyclic pyrimidine ring containing nitrogen atoms. n-methyl-4-pyrimidin-2-ylbenzylamine holds potential in medicinal chemistry and pharmaceutical research due to its unique structural features, making it a promising candidate for drug development. Additionally, its distinctive chemical structure and properties may render it suitable for various chemical reactions and synthesis processes in laboratory settings.
Uses
Used in Pharmaceutical Research:
N-methyl-4-pyrimidin-2-ylbenzylamine is utilized as a chemical intermediate for the development of new pharmaceuticals, leveraging its unique structural features to create novel drug candidates.
Used in Medicinal Chemistry:
n-methyl-4-pyrimidin-2-ylbenzylamine serves as a key component in the synthesis of potential therapeutic agents, contributing to the advancement of medicinal chemistry through its versatile chemical properties.
Used in Chemical Reactions and Synthesis Processes:
In the laboratory, n-methyl-4-pyrimidin-2-ylbenzylamine is employed as a reactant in various chemical reactions and synthesis processes, facilitating the creation of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 886851-48-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,8,5 and 1 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886851-48:
(8*8)+(7*8)+(6*6)+(5*8)+(4*5)+(3*1)+(2*4)+(1*8)=235
235 % 10 = 5
So 886851-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c1-13-9-10-3-5-11(6-4-10)12-14-7-2-8-15-12/h2-8,13H,9H2,1H3