88751-05-7 Usage
Uses
Used in Pharmaceutical Industry:
8-METHYL-IMIDAZO[1,2-A]PYRIDINE-2-CARBOXYLIC ACID is used as a key building block for the synthesis of various drug molecules and functional materials. Its unique molecular structure and properties contribute to the development of new drugs and bioactive compounds, enhancing their therapeutic potential and efficacy.
Used in Drug Development:
8-METHYL-IMIDAZO[1,2-A]PYRIDINE-2-CARBOXYLIC ACID is used as a precursor in the development of new drugs and bioactive compounds. Its incorporation into drug molecules can potentially improve their pharmacological properties, such as solubility, stability, and bioavailability, leading to more effective treatments for various diseases and disorders.
Used in Disease Treatment:
8-METHYL-IMIDAZO[1,2-A]PYRIDINE-2-CARBOXYLIC ACID has shown potential for use in the treatment of certain diseases and disorders. Its unique molecular structure and properties may contribute to the development of novel therapeutic agents that can target specific biological pathways or receptors, offering new treatment options for patients.
Check Digit Verification of cas no
The CAS Registry Mumber 88751-05-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,7,5 and 1 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 88751-05:
(7*8)+(6*8)+(5*7)+(4*5)+(3*1)+(2*0)+(1*5)=167
167 % 10 = 7
So 88751-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O2/c1-6-3-2-4-11-5-7(9(12)13)10-8(6)11/h2-5H,1H3,(H,12,13)
