887580-47-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Amino-4-pyridineacetic acid is used as a pharmaceutical compound for its potential role in the treatment of various neurological disorders. Its unique structure allows it to interact with specific biological targets, offering therapeutic benefits.
Used as a Chelating Agent in Chemical Industry:
In the field of chemistry, 2-Amino-4-pyridineacetic acid serves as a chelating agent for metal ion coordination. Its ability to form stable complexes with metal ions makes it useful in various chemical processes and applications.
Used in Drug Delivery and Targeting Research:
2-Amino-4-pyridineacetic acid is utilized as a component in drug delivery and targeting systems. Its properties enable the development of targeted drug delivery vehicles, potentially improving the efficacy and reducing the side effects of certain treatments.
Used in Antimicrobial Research:
In the field of microbiology, 2-Amino-4-pyridineacetic acid is studied for its ability to inhibit the growth of certain bacteria and fungi. This makes it a potentially valuable compound in the development of new antimicrobial agents to combat drug-resistant infections.
Check Digit Verification of cas no
The CAS Registry Mumber 887580-47-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,8 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 887580-47:
(8*8)+(7*8)+(6*7)+(5*5)+(4*8)+(3*0)+(2*4)+(1*7)=234
234 % 10 = 4
So 887580-47-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c8-6-3-5(1-2-9-6)4-7(10)11/h1-3H,4H2,(H2,8,9)(H,10,11)
