887584-91-0 Usage
Uses
Used in Pharmaceutical Industry:
3,4-Difluoro-5-hydroxybenzaldehyde is used as an intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and medicines. Its unique chemical structure allows it to be a key component in the creation of therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 3,4-Difluoro-5-hydroxybenzaldehyde is employed as an intermediate in the production of various agrochemicals, which are essential for enhancing crop protection and improving agricultural yields.
Used in Organic Chemistry:
3,4-Difluoro-5-hydroxybenzaldehyde is utilized as a building block in organic chemistry reactions, enabling the synthesis of a wide range of chemical products. Its versatility in chemical transformations makes it an important compound in organic synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 887584-91-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,8 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 887584-91:
(8*8)+(7*8)+(6*7)+(5*5)+(4*8)+(3*4)+(2*9)+(1*1)=250
250 % 10 = 0
So 887584-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H4F2O2/c8-5-1-4(3-10)2-6(11)7(5)9/h1-3,11H
