887587-46-4 Usage
Derived from piperidine
This indicates that the compound is based on the piperidine structure, which is a six-membered heterocyclic ring system.
Used in pharmaceutical synthesis
This indicates that the compound is commonly used as an intermediate in the production of various drugs.
Contains a carboxylic acid functional group
This indicates that the compound has a functional group consisting of a carbonyl group (C=O) and a hydroxyl group (-OH) bonded to the same carbon atom.
Has potential biological activity
This suggests that the compound may have effects on biological systems, making it a valuable compound in medical research and drug development.
Used as a building block in molecule synthesis
This indicates that the compound is versatile in its reactivity and can be used as a starting point for the synthesis of various other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 887587-46-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,5,8 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 887587-46:
(8*8)+(7*8)+(6*7)+(5*5)+(4*8)+(3*7)+(2*4)+(1*6)=254
254 % 10 = 4
So 887587-46-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c1-6-2-3-9-7(4-6)5-8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)
