887921-99-5 Usage
General Description
The chemical 5H-cyclopenta[b]pyridin-7-ol,6,7-dihydro-,(7S)- is a compound with the molecular formula C10H11NO. It is also known as (7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol and is a heterocyclic compound with a cyclopenta[b]pyridine core. This chemical is a chiral molecule with a stereocenter at the seventh position, resulting in two enantiomers, one of which is the (7S)-enantiomer. It has potential applications in medicinal chemistry and drug development due to its unique structure and potential biological activity. Further research and studies are needed to investigate its pharmacological properties and potential use in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 887921-99-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,9,2 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 887921-99:
(8*8)+(7*8)+(6*7)+(5*9)+(4*2)+(3*1)+(2*9)+(1*9)=245
245 % 10 = 5
So 887921-99-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO/c10-7-4-3-6-2-1-5-9-8(6)7/h1-2,5,7,10H,3-4H2/t7-/m0/s1
