887922-90-9 Usage
Uses
Used in Pharmaceutical Industry:
4-(1H-PYRAZOL-1-YLMETHYL)BENZALDEHYDE is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(1H-PYRAZOL-1-YLMETHYL)BENZALDEHYDE serves as an intermediate for the production of agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control and crop protection, thereby supporting sustainable agriculture.
Used in Organic Compounds Synthesis:
4-(1H-PYRAZOL-1-YLMETHYL)BENZALDEHYDE is utilized as an intermediate in the synthesis of a wide range of organic compounds. Its reactivity and structural features make it a valuable building block for creating complex organic molecules with diverse applications.
Used in Materials Science:
4-(1H-Pyrazol-1-ylmethyl)benzaldehyde is used in the field of materials science for the development of new functional materials and catalysts. Its unique chemical properties enable the creation of innovative materials with improved performance characteristics, such as enhanced catalytic activity or specific optical, electronic, or mechanical properties.
Used in Antioxidant and Antimicrobial Applications:
4-(1H-PYRAZOL-1-YLMETHYL)BENZALDEHYDE has been studied for its potential biological activities, including antioxidant and antimicrobial properties. Its ability to neutralize free radicals and inhibit microbial growth makes it a promising candidate for use in various applications, such as food preservation, cosmetics, and healthcare products.
Check Digit Verification of cas no
The CAS Registry Mumber 887922-90-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,9,2 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 887922-90:
(8*8)+(7*8)+(6*7)+(5*9)+(4*2)+(3*2)+(2*9)+(1*0)=239
239 % 10 = 9
So 887922-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O/c14-9-11-4-2-10(3-5-11)8-13-7-1-6-12-13/h1-7,9H,8H2