887922-91-0 Usage
General Description
4-[Methyl(aminomethyl)]-1-(6-methylpyrazin-2-yl)piperidine is a chemical compound with a complex structure, containing a piperidine ring substituted with a methyl(aminomethyl) group and a 6-methylpyrazin-2-yl group. 4-[Methyl(aminomethyl)]-1-(6-methylpyrazin-2-yl)piperidine belongs to the class of piperidine derivatives, which are often used in the pharmaceutical industry. The presence of the methyl(aminomethyl) and 6-methylpyrazin-2-yl groups in this compound makes it potentially useful in medicinal chemistry, particularly in the development of new drugs targeting the central nervous system. Additionally, the unique structure of this compound may lend itself to various chemical reactions and transformations, making it a potentially valuable building block for the synthesis of other complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 887922-91-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,7,9,2 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 887922-91:
(8*8)+(7*8)+(6*7)+(5*9)+(4*2)+(3*2)+(2*9)+(1*1)=240
240 % 10 = 0
So 887922-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H20N4/c1-10-7-14-9-12(15-10)16-5-3-11(4-6-16)8-13-2/h7,9,11,13H,3-6,8H2,1-2H3
