88798-13-4 Usage
Uses
Used in Pharmaceutical Research:
3-(Difluoromethoxy)phenol is utilized as a key intermediate in the synthesis of pharmaceutical compounds due to its unique reactivity and structural features. Its presence in the molecular structure can influence the pharmacokinetics and pharmacodynamics of the resulting drugs, potentially enhancing their therapeutic effects and safety profiles.
Used in Organic Synthesis:
As a versatile building block, 3-(Difluoromethoxy)phenol is employed in organic synthesis for the preparation of a variety of organic compounds. Its reactivity allows for the formation of diverse chemical entities, which can be further modified to achieve desired properties for specific applications.
Used in Antimicrobial Applications:
3-(Difluoromethoxy)phenol has been studied for its antimicrobial properties, making it a potential candidate for use in the development of new antimicrobial agents. Its ability to inhibit the growth of various microorganisms could contribute to the fight against antibiotic-resistant strains and the discovery of novel treatments for infectious diseases.
Used in Anticancer Research:
The anticancer potential of 3-(Difluoromethoxy)phenol has been a subject of interest, with research exploring its effects on cancer cells. It may be used as a lead compound in the development of new anticancer drugs, targeting specific molecular pathways or mechanisms involved in tumor growth and progression.
Used in Agrochemical Development:
3-(Difluoromethoxy)phenol's unique chemical properties also make it a valuable starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products could lead to the development of more effective and environmentally friendly solutions for agricultural challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 88798-13-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,7,9 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 88798-13:
(7*8)+(6*8)+(5*7)+(4*9)+(3*8)+(2*1)+(1*3)=204
204 % 10 = 4
So 88798-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F2O2/c8-7(9)11-6-3-1-2-5(10)4-6/h1-4,7,10H
88798-13-4Relevant academic research and scientific papers
6-(Nonsubstituted or substituted) phenoxy picolinic acids, process of preparing the same, and agricultural/horticultural germicides containing the same
-
, (2008/06/13)
An agricultural or horticultural fungicide containing 6-(unsubstituted or substituted) phenoxy picolinic acid represented by the general formula (I), as an effective ingredient. wherein R is a halogen atom, a C1to C4alkyl group, a C1to C4haloalkyl group, a C1to C4alkoxy group, a C1to C4haloalkoxy group, a C1to C4alkylthio group, a C1to C4alkylamino group, a di(C1to C4alkyl)amino group or a C7to C8aralkyl(C1to C4alkyl)amino group; n2is an integer of 0 to 3; Y is a C1to C4alkyl group, a C1to C4haloalkyl group, a C1to C4alkoxy group, a C1to C4haloalkoxy group, a C1to C4alkylthio group, a C1to C4haloalkylthio group or a halogen atom; and m is an integer of 0 to 5, and when m and n2are not less than 2, Rs and Ys may be the same or different, respectively. The compound is useful as an effective ingredient of agricultural or horticultural fungicides.
