888721-83-3 Usage
General Description
6-Bromopyrrolo[1,2-f][1,2,4]triazin-4(3H)-one, also known as 6-bromo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid, is an organic compound with the molecular formula C7H4BrN3O. It is a heterocyclic chemical with a pyrrolo-triazinone core structure. 6-broMopyrrolo[1,2-f][1,2,4]triazin-4(3H)-one is often used in organic synthesis and medicinal chemistry research. Some of its potential applications include its use as a building block in the synthesis of various bioactive compounds and pharmaceutical drugs. Its unique structural and chemical properties make it a valuable tool in the development of new pharmaceuticals and chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 888721-83-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,8,7,2 and 1 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 888721-83:
(8*8)+(7*8)+(6*8)+(5*7)+(4*2)+(3*1)+(2*8)+(1*3)=233
233 % 10 = 3
So 888721-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3O/c7-4-1-5-6(11)8-3-9-10(5)2-4/h1-3H,(H,8,9,11)
