88909-82-4 Usage
Uses
Used in Organic Synthesis:
9,10-Dihydro-1-benzo[a]pyrene-7(8H)-one Oxime is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows it to participate in a wide range of chemical reactions, making it a versatile building block for the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 9,10-Dihydro-1-benzo[a]pyrene-7(8H)-one Oxime is used as a precursor in the synthesis of potential drug candidates. Its unique chemical properties enable the development of new therapeutic agents with novel mechanisms of action, contributing to the advancement of medicine.
Used in Chemical Research:
9,10-Dihydro-1-benzo[a]pyrene-7(8H)-one Oxime is also used in chemical research as a model compound to study various chemical reactions and mechanisms. Its unique structure provides valuable insights into the behavior of similar compounds, aiding in the development of new synthetic methods and strategies.
Used in Material Science:
In the field of material science, 9,10-Dihydro-1-benzo[a]pyrene-7(8H)-one Oxime is utilized in the development of new materials with specific properties. Its unique chemical structure can be incorporated into the design of advanced materials, such as polymers, coatings, and sensors, with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 88909-82-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,9,0 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 88909-82:
(7*8)+(6*8)+(5*9)+(4*0)+(3*9)+(2*8)+(1*2)=194
194 % 10 = 4
So 88909-82-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H15NO/c22-21-18-6-2-5-15-16-10-9-13-4-1-3-12-7-8-14(11-17(15)18)20(16)19(12)13/h1,3-4,7-11,22H,2,5-6H2/b21-18+