889129-51-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-(4H-1,2,4-Triazol-4-yl)phenol is utilized as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its unique structure allows it to be a key component in the development of new drugs and pesticides, enhancing their efficacy and selectivity.
Used in Enzyme Inhibition:
2-(4H-1,2,4-Triazol-4-yl)phenol has been studied for its potential biological activity, particularly as an inhibitor of the enzyme xanthine oxidase. This role makes it a candidate for applications in the treatment of conditions related to xanthine oxidase activity, such as gout and certain cardiovascular diseases.
Used in Material Science:
2-(4H-1,2,4-Triazol-4-yl)phenol has been investigated for its use in the development of new materials with specific properties. Its unique structure and reactivity make it suitable for the creation of polymers and organic electronics, where it can contribute to the development of advanced materials with tailored characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 889129-51-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,9,1,2 and 9 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 889129-51:
(8*8)+(7*8)+(6*9)+(5*1)+(4*2)+(3*9)+(2*5)+(1*1)=225
225 % 10 = 5
So 889129-51-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O/c12-8-4-2-1-3-7(8)11-5-9-10-6-11/h1-6,12H
