88980-06-7 Usage
Uses
Used in Pharmaceutical Development:
2(s)-Carboxypiperidine[d]imidazoleHCl is used as a pharmaceutical intermediate for the synthesis of various drug candidates. Its unique structure and properties make it a valuable component in the development of new medications with potential therapeutic applications.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2(s)-Carboxypiperidine[d]imidazoleHCl serves as a key building block for the design and synthesis of novel bioactive molecules. Its presence in a compound can influence the molecule's pharmacokinetic and pharmacodynamic properties, making it an essential tool for researchers in drug discovery and optimization processes.
Used in Drug Delivery Systems:
2(s)-Carboxypiperidine[d]imidazoleHCl can be employed as a component in drug delivery systems to improve the bioavailability and targeted delivery of therapeutic agents. Its chemical properties may facilitate the encapsulation or conjugation of drugs to various carriers, enhancing their efficacy and reducing side effects.
Used in Biochemical Assays and Diagnostics:
Due to its chemical reactivity and structural features, 2(s)-Carboxypiperidine[d]imidazoleHCl can be utilized in the development of biochemical assays and diagnostic tools. It may serve as a probe or a label in various analytical techniques, aiding in the detection and quantification of biological molecules or processes.
Check Digit Verification of cas no
The CAS Registry Mumber 88980-06-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,9,8 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 88980-06:
(7*8)+(6*8)+(5*9)+(4*8)+(3*0)+(2*0)+(1*6)=187
187 % 10 = 7
So 88980-06-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O2.ClH/c11-7(12)5-1-4-6(2-8-5)10-3-9-4;/h3,5,8H,1-2H2,(H,9,10)(H,11,12);1H/t5-;/m0./s1
