889942-40-9 Usage
Description
4-BENZYL-5H-THIAZOLE-2-THIONE is a chemical compound with the molecular formula C11H9NS2, belonging to the thiazole and thione derivatives. It is widely recognized for its potential applications in organic synthesis, pharmaceutical research, and various therapeutic areas due to its antimicrobial, antioxidant, anti-inflammatory, and antitumor properties.
Uses
Used in Pharmaceutical Research:
4-BENZYL-5H-THIAZOLE-2-THIONE is used as a key intermediate in the synthesis of various pharmaceuticals for its potential antimicrobial, antioxidant, and anti-inflammatory properties. Its unique structure allows it to be a promising candidate for the development of new drugs targeting a range of health conditions.
Used in Antitumor and Anticancer Applications:
In the field of oncology, 4-BENZYL-5H-THIAZOLE-2-THIONE is utilized as an antitumor and anticancer agent. Its potential to inhibit the growth of cancer cells and its ability to target specific molecular pathways make it a valuable compound in the search for novel cancer therapies.
Used in Enzyme Inhibition:
4-BENZYL-5H-THIAZOLE-2-THIONE serves as an inhibitor of certain enzymes, which can be crucial in the regulation of various biological processes and diseases. Its enzyme inhibitory properties allow it to be employed in the development of treatments for specific enzyme-related disorders.
Used as a Chelating Agent in Materials Science:
In materials science, 4-BENZYL-5H-THIAZOLE-2-THIONE is used as a chelating agent for various metal ions. Its ability to form stable complexes with metal ions can be applied in the development of new materials with specific properties, such as catalysts, sensors, or advanced materials for different industries.
Overall, 4-BENZYL-5H-THIAZOLE-2-THIONE's diverse applications in medicine, pharmacology, and materials science highlight its potential as a versatile and valuable chemical compound with promising future prospects.
Check Digit Verification of cas no
The CAS Registry Mumber 889942-40-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,9,9,4 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 889942-40:
(8*8)+(7*8)+(6*9)+(5*9)+(4*4)+(3*2)+(2*4)+(1*0)=249
249 % 10 = 9
So 889942-40-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NS2/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2
