890007-12-2 Usage
Uses
Used in Pharmaceutical Industry:
3-(4-METHYLPHENYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID is used as an intermediate in the synthesis of pharmaceutical compounds for its potential biological activity. Its structural features allow for the development of new drugs with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 3-(4-METHYLPHENYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID serves as a key building block for the creation of more complex organic molecules. Its carboxylic acid functional group and methylphenyl substituent enable it to participate in various chemical reactions, facilitating the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 890007-12-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,0,0,0 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 890007-12:
(8*8)+(7*9)+(6*0)+(5*0)+(4*0)+(3*7)+(2*1)+(1*2)=152
152 % 10 = 2
So 890007-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-7-2-4-8(5-3-7)9-6-10(11(14)15)13-12-9/h2-6H,1H3,(H,12,13)(H,14,15)
