89026-20-0 Usage
Uses
Used in Pharmaceutical Research:
4-(2-AMINO-ETHYL)-5-METHYL-1H-IMIDAZOL-2-YLAMINE is used as a research compound for its potential antifungal and antibacterial properties, making it a valuable component in the development of new drugs.
Used in Organic Synthesis:
In the field of organic synthesis, 4-(2-AMINO-ETHYL)-5-METHYL-1H-IMIDAZOL-2-YLAMINE is used as a building block for the creation of various chemical compounds.
Used in Neurological Disorders Treatment:
4-(2-AMINO-ETHYL)-5-METHYL-1H-IMIDAZOL-2-YLAMINE is used as a potential therapeutic agent for treating neurological disorders due to its ability to modulate certain receptors in the brain.
Overall, 4-(2-amino-ethyl)-5-methyl-1H-imidazol-2-ylamine is a versatile compound with various potential applications in the fields of medicine and chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 89026-20-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,0,2 and 6 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89026-20:
(7*8)+(6*9)+(5*0)+(4*2)+(3*6)+(2*2)+(1*0)=140
140 % 10 = 0
So 89026-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N4/c1-4-5(2-3-7)10-6(8)9-4/h2-3,7H2,1H3,(H3,8,9,10)
