890621-13-3 Usage
General Description
3-(2-Chlorophenyl)-1H-pyrazole-5-carboxylic acid is a compound with the molecular formula C10H7ClN2O2. It is a pyrazole derivative with a carboxylic acid functional group and a chlorophenyl substituent. 3-(2-CHLOROPHENYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID is commonly used in the pharmaceutical industry as a building block for the synthesis of various biologically active molecules, particularly in the development of potential drug candidates. Its structure and properties make it suitable for modulating specific biological targets, such as enzymes or receptors, for the treatment of different diseases. Additionally, its carboxylic acid group provides the potential for derivatization and modification to enhance its pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 890621-13-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,0,6,2 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 890621-13:
(8*8)+(7*9)+(6*0)+(5*6)+(4*2)+(3*1)+(2*1)+(1*3)=173
173 % 10 = 3
So 890621-13-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7ClN2O2/c11-7-4-2-1-3-6(7)8-5-9(10(14)15)13-12-8/h1-5H,(H,12,13)(H,14,15)