890652-02-5 Usage
Uses
Used in Pharmaceutical Industry:
5-METHYL-1-PROPYL-1H-PYRAZOLE-4-CARBALDEHYDE is used as a chemical intermediate for the synthesis of new drugs. Its aldehyde group enables the creation of a wide range of derivatives with different therapeutic properties, contributing to the development of innovative pharmaceutical compounds.
Used in Agrochemical Industry:
5-METHYL-1-PROPYL-1H-PYRAZOLE-4-CARBALDEHYDE is used as a building block in the preparation of agrochemicals. Its reactivity allows for the synthesis of various organic compounds with potential applications in agriculture, such as pesticides, herbicides, and other crop protection agents, enhancing crop yield and quality.
Check Digit Verification of cas no
The CAS Registry Mumber 890652-02-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,0,6,5 and 2 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 890652-02:
(8*8)+(7*9)+(6*0)+(5*6)+(4*5)+(3*2)+(2*0)+(1*2)=185
185 % 10 = 5
So 890652-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O/c1-3-4-10-7(2)8(6-11)5-9-10/h5-6H,3-4H2,1-2H3
