89123-72-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-5-chloropyridazin-4-ylamine is used as an intermediate in the synthesis of various pharmaceutical compounds for its potential biological activities.
Used in Agrochemical Industry:
3-Amino-5-chloropyridazin-4-ylamine is used as an intermediate in the development of agricultural chemicals, such as fungicides, due to its potential applications in controlling plant diseases.
Used in Antitumor Applications:
3-Amino-5-chloropyridazin-4-ylamine is studied for its potential use as an antitumor agent, indicating its possible role in the development of cancer treatments.
Used in Drug Synthesis:
3-Amino-5-chloropyridazin-4-ylamine is utilized as a building block in the synthesis of various drug molecules, contributing to the discovery and development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89123-72-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,1,2 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89123-72:
(7*8)+(6*9)+(5*1)+(4*2)+(3*3)+(2*7)+(1*2)=148
148 % 10 = 8
So 89123-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C4H5ClN4/c5-2-1-8-9-4(7)3(2)6/h1H,(H2,6,8)(H2,7,9)
