891503-79-0 Usage
Uses
Used in Organic Synthesis:
1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide is used as a reagent in organic synthesis for its ability to participate in a range of chemical reactions, facilitating the formation of complex organic molecules.
Used as a Catalyst in Chemical Reactions:
In the realm of catalysis, 1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide is utilized to accelerate chemical reactions, enhancing the rate of reaction and improving the overall efficiency of the process.
Used in Pharmaceutical Industry:
1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide is employed as a key intermediate in the synthesis of potential drug candidates, leveraging its unique chemical properties to contribute to the development of new medications.
Used in Research and Development:
In the scientific community, 1,2,3-Trimethyl-1-(2-propen-1-yl)-1H-benz[e]indolium bromide serves as a valuable compound for research and development, providing insights into the properties and behaviors of benz[e]indolium derivatives and their applications in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 891503-79-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,1,5,0 and 3 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 891503-79:
(8*8)+(7*9)+(6*1)+(5*5)+(4*0)+(3*3)+(2*7)+(1*9)=190
190 % 10 = 0
So 891503-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N.BrH/c1-5-12-18(3)13(2)19(4)16-11-10-14-8-6-7-9-15(14)17(16)18;/h5-11H,1,12H2,2-4H3;1H/q+1;/p-1
891503-79-0Relevant academic research and scientific papers
Optical Recording Material and Optical Recording Medium
-
Page/Page column 12, (2010/11/29)
An optical recording material for use in an optical recording layer of an optical recording medium comprising the optical recording layer provided on a substrate, the optical recording material comprising a cyanine compound represented by general formula
