89204-92-2 Usage
Uses
Used in Pharmaceutical Industry:
Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a building block for the creation of new drugs, contributing to the advancement of medicinal chemistry.
Used in Academic Research:
In the field of academic research, Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate serves as a reference compound. It is used to study the properties and behavior of oxazole derivatives, providing insights into their reactivity, stability, and potential applications in chemical reactions and biological processes. This research can lead to a better understanding of the mechanisms involved in drug action and the development of more effective therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89204-92-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,2,0 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89204-92:
(7*8)+(6*9)+(5*2)+(4*0)+(3*4)+(2*9)+(1*2)=152
152 % 10 = 2
So 89204-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClNO3/c1-15-11(14)9-10(16-6-13-9)7-3-2-4-8(12)5-7/h2-6H,1H3
