89204-92-2 Usage
Description
Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is a chemical compound characterized by the molecular formula C11H8ClNO3. It is an oxazole derivative, which is a five-membered aromatic heterocyclic compound that includes one oxygen and one nitrogen atom within its ring structure. Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is recognized for its potential in the pharmaceutical industry, particularly as an intermediate in the synthesis of a variety of drugs and pharmaceutical compounds. Its unique structural and functional attributes make it a valuable candidate for the development of new medications and for use in academic research to explore the properties and behavior of oxazole derivatives in chemical reactions and biological processes.
Uses
Used in Pharmaceutical Industry:
Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a building block for the creation of new drugs, contributing to the advancement of medicinal chemistry.
Used in Academic Research:
In the field of academic research, Methyl 5-(3-chlorophenyl)-1,3-oxazole-4-carboxylate serves as a reference compound. It is used to study the properties and behavior of oxazole derivatives, providing insights into their reactivity, stability, and potential applications in chemical reactions and biological processes. This research can lead to a better understanding of the mechanisms involved in drug action and the development of more effective therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89204-92-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,2,0 and 4 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89204-92:
(7*8)+(6*9)+(5*2)+(4*0)+(3*4)+(2*9)+(1*2)=152
152 % 10 = 2
So 89204-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClNO3/c1-15-11(14)9-10(16-6-13-9)7-3-2-4-8(12)5-7/h2-6H,1H3