89239-18-9 Usage
Uses
Used in Pharmaceutical Industry:
7-chloro-1,3-dimethyl-1H-pyrazolo[4,3-d]pyrimidine is used as a building block for the synthesis of various biologically active compounds. Its unique structure allows for the creation of diverse pharmaceutical agents with potential therapeutic benefits.
Used in Medicinal Chemistry Research:
7-chloro-1,3-dimethyl-1H-pyrazolo[4,3-d]pyrimidine is utilized as a subject of interest for further research and development in the field of medicinal chemistry. Its potential anti-inflammatory and anti-cancer properties make it a promising candidate for the development of new drugs to address these health concerns.
Used in Drug Development:
7-chloro-1,3-dimethyl-1H-pyrazolo[4,3-d]pyrimidine has been investigated as a potential candidate for the development of new drugs. Studies have shown that it exhibits promising biological activities, which could lead to the creation of novel therapeutic agents for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 89239-18-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,2,3 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 89239-18:
(7*8)+(6*9)+(5*2)+(4*3)+(3*9)+(2*1)+(1*8)=169
169 % 10 = 9
So 89239-18-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN4/c1-4-5-6(12(2)11-4)7(8)10-3-9-5/h3H,1-2H3
