892501-89-2 Usage
General Description
N-Methyl-3-(1,3-thiazol-2-yl)benzylamine is a chemical compound with the molecular formula C11H12N2S. It is a derivative of benzylamine that contains a thiazole ring and a methyl group. N-Methyl-3-(1,3-thiazol-2-yl)benzylamine is commonly used as a building block in the synthesis of various pharmaceuticals and organic chemicals. It has several potential applications in the field of medicinal chemistry, particularly in the development of new drugs for the treatment of various diseases. The compound's unique structure and properties make it a valuable intermediate for the synthesis of biologically active compounds. Additionally, its thiazole moiety may contribute to its biological and pharmacological properties, making it a promising target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 892501-89-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,2,5,0 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 892501-89:
(8*8)+(7*9)+(6*2)+(5*5)+(4*0)+(3*1)+(2*8)+(1*9)=192
192 % 10 = 2
So 892501-89-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2S/c1-12-8-9-3-2-4-10(7-9)11-13-5-6-14-11/h2-7,12H,8H2,1H3