892874-27-0 Usage
General Description
The chemical compound "(3-thiophen-2-ylmethyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid" is a potentially biologically active molecule with a complex structure consisting of a thiophene ring, a triazole ring, and a carboxylic acid functional group. The compound's structure suggests potential reactivity and interactions with biological systems, making it of interest for medicinal and biological research. The presence of the thiazole and thiophene groups also implies potential aromatic and electronic properties, which may contribute to its biological activity. Further investigation and study are needed to understand the specific roles and potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 892874-27-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,2,8,7 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 892874-27:
(8*8)+(7*9)+(6*2)+(5*8)+(4*7)+(3*4)+(2*2)+(1*7)=230
230 % 10 = 0
So 892874-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3O2S2/c13-8(14)5-12-7(10-11-9(12)15)4-6-2-1-3-16-6/h1-3H,4-5H2,(H,11,15)(H,13,14)
