89329-09-9 Usage
General Description
The chemical (2R-trans)-2-[2,2-bis(4-fluorophenyl)-1,3-benzodioxol-5-yl]-3,4-dihydro-2H-1-benzopyran-3,5,7-triol is a complex compound with a unique structure. It consists of a benzodioxol ring with two 4-fluorophenyl groups attached, as well as a benzopyran ring with three hydroxyl groups. The compound is classified as a dihydrobenzopyran-triol, indicating the presence of three hydroxyl groups. This chemical may have potential applications in the field of medicinal chemistry or drug development, as compounds with similar structures have been investigated for their biological activities, including anti-inflammatory and antioxidant properties. The specific properties and potential uses of this compound would require further research and study.
Check Digit Verification of cas no
The CAS Registry Mumber 89329-09-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,3,2 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 89329-09:
(7*8)+(6*9)+(5*3)+(4*2)+(3*9)+(2*0)+(1*9)=169
169 % 10 = 9
So 89329-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H20F2O6/c29-18-6-2-16(3-7-18)28(17-4-8-19(30)9-5-17)35-24-10-1-15(11-26(24)36-28)27-23(33)14-21-22(32)12-20(31)13-25(21)34-27/h1-13,23,27,31-33H,14H2/t23-,27+/m0/s1