89379-73-7 Usage
Uses
Used in Pharmaceutical Industry:
4-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical drugs. Its unique structure and properties make it a promising candidate for the development of drugs targeting diseases related to pyrimidine metabolism or other biological processes involving pyrimidine derivatives.
Used in Medicinal Chemistry Research:
4-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo(9CI) serves as a valuable compound in medicinal chemistry research. It can be used to explore the structure-activity relationships of pyrimidine-based drugs and to identify potential therapeutic agents with improved efficacy and selectivity.
Further research and analysis are required to fully understand the properties and potential uses of 4-Pyrimidinecarboxylic acid, 1,2-dihydro-2-oxo(9CI) in various applications. Its unique structure and potential role in pyrimidine metabolism make it an interesting compound for the development of novel pharmaceutical drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89379-73-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,3,7 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 89379-73:
(7*8)+(6*9)+(5*3)+(4*7)+(3*9)+(2*7)+(1*3)=197
197 % 10 = 7
So 89379-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3/c8-4(9)3-1-2-6-5(10)7-3/h1-2H,(H,8,9)(H,6,7,10)
