89417-84-5 Usage
Uses
Used in Pharmaceutical Industry:
3-ETHOXY-5-METHYL-4H-1,2,4-TRIAZOLE is used as a building block for the synthesis of pharmaceutical drugs due to its unique chemical structure and properties. Its ability to form stable compounds with a variety of other molecules makes it a valuable component in the development of new medications.
Used in Medicinal Chemistry Research:
3-ETHOXY-5-METHYL-4H-1,2,4-TRIAZOLE is used as a research compound for exploring its potential anti-inflammatory and anti-cancer properties. Its presence in various drug candidates is being investigated to understand its role in modulating biological pathways and its efficacy in treating specific diseases.
Used in Agriculture:
In the agricultural sector, 3-ETHOXY-5-METHYL-4H-1,2,4-TRIAZOLE is used as a component in the development of agrochemicals, such as fungicides and pesticides. Its ability to inhibit the growth of certain pathogens makes it a valuable asset in crop protection and disease management.
Used in Materials Science:
3-ETHOXY-5-METHYL-4H-1,2,4-TRIAZOLE also finds applications in materials science, where it is utilized in the synthesis of advanced materials with specific properties. Its unique chemical structure allows it to contribute to the development of materials with improved performance characteristics in various applications, such as sensors, catalysts, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 89417-84-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,1 and 7 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 89417-84:
(7*8)+(6*9)+(5*4)+(4*1)+(3*7)+(2*8)+(1*4)=175
175 % 10 = 5
So 89417-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3O/c1-3-9-5-6-4(2)7-8-5/h3H2,1-2H3,(H,6,7,8)
