89418-10-0 Usage
Uses
Used in Research and Development:
Pyrazolo[1,5-a]pyrimidin-5(4H)-one, 7-amino(9CI) is employed as a research chemical for the synthesis of various organic compounds. Its unique structure makes it a valuable building block in the development of new chemical entities with potential applications in different fields.
Used in Pharmaceutical Development:
Due to its structural features and potential to interact with biological systems, Pyrazolo[1,5-a]pyrimidin-5(4H)-one, 7-amino(9CI) may have pharmaceutical applications. It is used as a starting point for the design and synthesis of new drug candidates, particularly in the search for novel therapeutic agents. Further research is necessary to explore its pharmacological properties and efficacy in treating specific medical conditions.
Used in Chemical Synthesis Industry:
In the chemical synthesis industry, Pyrazolo[1,5-a]pyrimidin-5(4H)-one, 7-amino(9CI) is used as a key intermediate in the production of complex organic molecules. Its versatility in forming various chemical bonds and its compatibility with different synthetic routes make it an essential component in the creation of advanced materials and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 89418-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,1 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89418-10:
(7*8)+(6*9)+(5*4)+(4*1)+(3*8)+(2*1)+(1*0)=160
160 % 10 = 0
So 89418-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O/c7-4-3-6(11)9-5-1-2-8-10(4)5/h1-3H,7H2,(H,9,11)
