89446-58-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2,4-Diamino-5-(bromomethyl)pyrimidine is used as a key intermediate in the synthesis of various pharmaceuticals and bioactive molecules. Its unique structure allows for the development of new drugs with potential therapeutic effects against different diseases.
Used in Organic Synthesis:
As a building block in organic synthesis, 2,4-Diamino-5-(bromomethyl)pyrimidine enables the creation of a wide range of chemical compounds. Its reactivity and functional groups make it a valuable component in the synthesis of complex organic molecules.
Used in Material Development:
2,4-Diamino-5-(bromomethyl)pyrimidine has potential applications in the development of new materials. Its chemical properties can be utilized to create innovative materials with unique properties for various industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,4-Diamino-5-(bromomethyl)pyrimidine plays a crucial role in the development of new drugs for various diseases. Its versatile structure allows for the design and synthesis of novel drug candidates with improved therapeutic profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 89446-58-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,4 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 89446-58:
(7*8)+(6*9)+(5*4)+(4*4)+(3*6)+(2*5)+(1*8)=182
182 % 10 = 2
So 89446-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H7BrN4.2BrH/c6-1-3-2-9-5(8)10-4(3)7;;/h2H,1H2,(H4,7,8,9,10);2*1H
