89499-33-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Thiophenecarboxylic acid, 4-amino-, hydrochloride is used as a starting material for the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Thiophenecarboxylic acid, 4-amino-, hydrochloride serves as a precursor for the synthesis of various agrochemicals, including pesticides and herbicides, contributing to the development of more effective and environmentally friendly products.
Used in Dye and Pigment Production:
2-Thiophenecarboxylic acid, 4-amino-, hydrochloride is used in the production of dyes and pigments due to its ability to form colored compounds. This application is valuable in various industries, such as textiles, plastics, and printing inks, where colorants are required.
Used in Organic Compound Synthesis:
As a versatile building block, 2-Thiophenecarboxylic acid, 4-amino-, hydrochloride is utilized in the synthesis of other organic compounds for research and development purposes. Its reactivity and functional groups make it a valuable component in the creation of novel molecules with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 89499-33-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,4,9 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 89499-33:
(7*8)+(6*9)+(5*4)+(4*9)+(3*9)+(2*3)+(1*3)=202
202 % 10 = 2
So 89499-33-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NO2S.ClH/c6-3-1-4(5(7)8)9-2-3;/h1-2H,6H2,(H,7,8);1H
