89533-85-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Furancarboxylic acid, tetrahydro-4-methyl-5-oxo-(9CI) is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a valuable building block in the development of new drugs.
Used in Organic Chemistry:
In the field of organic chemistry, 3-Furancarboxylic acid, tetrahydro-4-methyl-5-oxo-(9CI) serves as a key component in the synthesis of complex organic molecules. Its reactivity and functional groups make it a versatile compound for creating a wide range of organic compounds.
Used in Medicinal Research:
3-Furancarboxylic acid, tetrahydro-4-methyl-5-oxo-(9CI) is used in medicinal research for its potential biological activity. Scientists are studying its properties to explore its potential as a therapeutic agent in various medical applications.
Used in Chemical Industry:
In the chemical industry, 3-Furancarboxylic acid, tetrahydro-4-methyl-5-oxo-(9CI) is utilized as a raw material for the production of various chemical products. Its unique properties make it suitable for use in the synthesis of specialty chemicals and intermediates.
Check Digit Verification of cas no
The CAS Registry Mumber 89533-85-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,3 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 89533-85:
(7*8)+(6*9)+(5*5)+(4*3)+(3*3)+(2*8)+(1*5)=177
177 % 10 = 7
So 89533-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O4/c1-3-4(5(7)8)2-10-6(3)9/h3-4H,2H2,1H3,(H,7,8)
