89581-80-6 Usage
Uses
Used in Pharmaceutical Chemistry:
2-chloro-8-(methylthio)-7H-purine serves as a key building block for the synthesis of various nucleotide analogs and other biologically active compounds. Its presence in these molecules can modulate their interactions with enzymes, receptors, and other biological targets, leading to the development of novel therapeutic agents with improved efficacy and selectivity.
Used in Research Studies:
As a research tool, 2-chloro-8-(methylthio)-7H-purine is utilized in investigations related to nucleic acids, enzymes, and purinergic receptors. Its unique chemical properties allow for the exploration of structure-activity relationships, the elucidation of molecular mechanisms, and the identification of potential drug targets in these areas.
Used in Drug Development:
2-chloro-8-(methylthio)-7H-purine's specific chemical and pharmacological properties make it a promising candidate for the development of new drugs targeting a variety of diseases and conditions. Its potential applications may include the treatment of viral infections, cancer, inflammatory disorders, and neurological diseases, among others.
Used in Drug Synthesis:
2-chloro-8-(methylthio)-7H-purine is employed as an intermediate in the synthesis of various pharmaceuticals, including antiviral agents, immunosuppressants, and anticancer drugs. Its presence in these molecules can enhance their potency, selectivity, and pharmacokinetic properties, contributing to the development of more effective and safer therapeutic options.
Check Digit Verification of cas no
The CAS Registry Mumber 89581-80-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,8 and 1 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89581-80:
(7*8)+(6*9)+(5*5)+(4*8)+(3*1)+(2*8)+(1*0)=186
186 % 10 = 6
So 89581-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN4S/c1-12-6-9-3-2-8-5(7)10-4(3)11-6/h2H,1H3,(H,8,9,10,11)
