89677-46-3 Usage
Uses
Used in Organic Synthesis:
(2,4-DIBROMO-5-METHOXY)BENZENEBORONIC ACID is used as a building block for the preparation of various pharmaceuticals and agrochemicals. Its boronic acid functionality allows it to undergo Suzuki-Miyaura coupling reactions, making it a valuable reagent in the formation of carbon-carbon bonds.
Used in Pharmaceutical Development:
(2,4-DIBROMO-5-METHOXY)BENZENEBORONIC ACID is used as a key intermediate in the synthesis of bioactive compounds. The presence of halogen atoms and a methoxy group on the benzene ring makes the compound highly versatile for further functionalization in organic chemistry, enabling the development of new drugs with improved properties.
Used in Agrochemicals:
(2,4-DIBROMO-5-METHOXY)BENZENEBORONIC ACID is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its unique structure and reactivity contribute to the development of effective and environmentally friendly agrochemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 89677-46-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,6,7 and 7 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 89677-46:
(7*8)+(6*9)+(5*6)+(4*7)+(3*7)+(2*4)+(1*6)=203
203 % 10 = 3
So 89677-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BBr2O3/c1-13-7-2-4(8(11)12)5(9)3-6(7)10/h2-3,11-12H,1H3
