89715-82-2 Usage
Uses
Used in Oncology:
5-HYDRAZINO-6-AZAURACIL is used as an antineoplastic agent for its potential to impede the synthesis of guanosine nucleotides, which are essential for the replication of DNA and RNA in cancer cells. This mechanism of action may lead to the disruption of cancer cell proliferation and could be instrumental in the development of novel cancer therapies.
Used in Antiviral Research:
5-HYDRAZINO-6-AZAURACIL is also being explored for its potential as an antiviral agent. Given its ability to interfere with nucleotide synthesis, it may have applications in inhibiting viral replication, which could be beneficial in the treatment of viral infections.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 5-HYDRAZINO-6-AZAURACIL is used as a compound in the research and development of new drugs. Its unique mechanism of action as a purine analog positions it as a candidate for further investigation into its therapeutic potential against various diseases, particularly those involving abnormal cell proliferation such as cancer and viral infections.
Check Digit Verification of cas no
The CAS Registry Mumber 89715-82-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,7,1 and 5 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89715-82:
(7*8)+(6*9)+(5*7)+(4*1)+(3*5)+(2*8)+(1*2)=182
182 % 10 = 2
So 89715-82-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N5O2/c4-6-1-2(9)5-3(10)8-7-1/h4H2,(H,6,7)(H2,5,8,9,10)
