89806-50-8 Usage
Molecular structure
The compound has a complex molecular structure with multiple rings and functional groups.
Benzothiazolium ring
It contains a 3-ethyl-1,3-benzothiazol-3-ium-2-yl group.
Cyclopenten rings
The compound has a 1-cyclopenten-1-yl group.
Carbon-carbon double bonds
It includes multiple (E)-2-ethenyl and (E)-2-ethylidene groups.
1-Oxo-1H-inden-3-olate group
The compound has a 1-oxo-1H-inden-3-olate functional group.
Potential applications
Due to its complex structure, it may have potential applications in medicinal chemistry, materials science, or other fields that utilize complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 89806-50-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,8,0 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89806-50:
(7*8)+(6*9)+(5*8)+(4*0)+(3*6)+(2*5)+(1*0)=178
178 % 10 = 8
So 89806-50-8 is a valid CAS Registry Number.
InChI:InChI=1/C36H30N2O2S2/c1-3-37-27-13-7-9-15-29(27)41-31(37)21-19-23-17-18-24(20-22-32-38(4-2)28-14-8-10-16-30(28)42-32)33(23)34-35(39)25-11-5-6-12-26(25)36(34)40/h5-16,19-22H,3-4,17-18H2,1-2H3/b23-19+,31-21-