898746-50-4 Usage
Uses
Used in Pharmaceutical Industry:
5-IODO-1H-PYRROLO[2,3-B]PYRIDINE is used as a key intermediate in the synthesis of various drugs, leveraging its unique structural properties to create new compounds with potential therapeutic effects.
Used in Agrochemical Industry:
5-IODO-1H-PYRROLO[2,3-B]PYRIDINE is utilized as a building block in the development of agrochemicals, contributing to the creation of novel compounds with applications in agriculture for pest control and crop protection.
Used in Medicinal Chemistry Research:
5-IODO-1H-PYRROLO[2,3-B]PYRIDINE is employed as a research compound for exploring its potential in the development of new drugs targeting various biological pathways, such as those implicated in cancer and inflammatory diseases.
Used in Chemical Biology Research:
5-IODO-1H-PYRROLO[2,3-B]PYRIDINE is studied as a potential inhibitor of protein kinases, which play a crucial role in regulating numerous cellular processes. Its investigation contributes to understanding its effects on cellular functions and its possible applications in therapeutic interventions.
Overall, 5-IODO-1H-PYRROLO[2,3-B]PYRIDINE's versatile nature and potential applications make it a compound of significant interest to researchers in the fields of medicinal chemistry and chemical biology, with implications for both human health and agricultural advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 898746-50-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,4 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 898746-50:
(8*8)+(7*9)+(6*8)+(5*7)+(4*4)+(3*6)+(2*5)+(1*0)=254
254 % 10 = 4
So 898746-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)
