898747-36-9 Usage
Uses
Used in Pharmaceutical Industry:
7-Methoxycarbonyl-1H-indazole-3-carboxylic acid is used as a building block for the synthesis of various biologically active molecules. Its unique structure and functional groups make it a valuable intermediate in the development of new drugs and pharmaceuticals, enhancing the therapeutic potential of these compounds.
Used in Drug Synthesis:
7-Methoxycarbonyl-1H-indazole-3-carboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals. Its presence of methoxy and carboxylic acid functional groups allows for further chemical modifications and the creation of novel drug candidates with improved pharmacological properties.
Used in Medicinal Chemistry Research:
7-Methoxycarbonyl-1H-indazole-3-carboxylic acid is utilized as a research tool in medicinal chemistry. Its unique structure and functional groups provide insights into the design and optimization of new drug molecules, contributing to the advancement of pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 898747-36-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,4 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898747-36:
(8*8)+(7*9)+(6*8)+(5*7)+(4*4)+(3*7)+(2*3)+(1*6)=259
259 % 10 = 9
So 898747-36-9 is a valid CAS Registry Number.
InChI:InChI=1S/C10H8N2O4/c1-16-10(15)6-4-2-3-5-7(6)11-12-8(5)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)
