898754-06-8 Usage
Description
2',4'-DIFLUORO-3-(2,5-DIMETHYLPHENYL)PROPIOPHENONE is a chemical compound with a molecular formula of C18H15F2O. It is a propiophenone derivative featuring two fluorine atoms and a 2,5-dimethylphenyl group attached to the third carbon of the propiophenone backbone. 2',4'-DIFLUORO-3-(2,5-DIMETHYLPHENYL)PROPIOPHENONE holds potential applications in the pharmaceutical industry, particularly in the development of new drugs and medications. Its specific uses and properties may vary depending on the context and intended application.
Uses
Used in Pharmaceutical Industry:
2',4'-DIFLUORO-3-(2,5-DIMETHYLPHENYL)PROPIOPHENONE is used as a chemical intermediate for the synthesis of new drugs and medications. Its unique structure, including the fluorine atoms and the 2,5-dimethylphenyl group, may contribute to the development of pharmaceuticals with specific therapeutic properties, such as enhanced bioavailability, target specificity, or improved pharmacokinetics. 2',4'-DIFLUORO-3-(2,5-DIMETHYLPHENYL)PROPIOPHENONE's role in drug development can be crucial for creating innovative treatments and addressing unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 898754-06-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898754-06:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*4)+(2*0)+(1*6)=248
248 % 10 = 8
So 898754-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H16F2O/c1-11-3-4-12(2)13(9-11)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
