898754-78-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2',5'-DIMETHYL-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 2',5'-DIMETHYL-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE serves as a versatile building block for the creation of a wide range of organic compounds. Its reactivity and functional groups enable the formation of diverse chemical entities with potential applications in various industries.
Used in Research and Development:
2',5'-DIMETHYL-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is extensively utilized in research and development, particularly in the field of medicinal chemistry. Its unique properties and structure make it an important tool for exploring new chemical reactions and developing innovative compounds with therapeutic potential.
Used in Medicinal Chemistry:
In the medicinal chemistry industry, 2',5'-DIMETHYL-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is used as a starting material for the design and synthesis of novel drug candidates. Its unique structural features and reactivity contribute to the development of new therapeutic agents with improved pharmacological properties and targeted applications.
Check Digit Verification of cas no
The CAS Registry Mumber 898754-78-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898754-78:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*4)+(2*7)+(1*8)=264
264 % 10 = 4
So 898754-78-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H20OS/c1-13-8-9-14(2)16(12-13)17(19)11-10-15-6-4-5-7-18(15)20-3/h4-9,12H,10-11H2,1-3H3
